1,4-Diamino-2,3-dichloroanthracene-9,10-dione | CAS No. 70956-27-3

1,4-Diamino-2,3-dichloroanthracene-9,10-dione

Basic Information

CAS Number

70956-27-3

Molecular Formula

C14H8N2O2Cl2

Molecular Weight

307.13 g/mol

AD

Basic Physical Properties

NC1C2=C(C(=O)C3C(C2=O)=CC=CC=3)C(N)=C(Cl)C=1Cl

InChI

InChI=1S/C14H8Cl2N2O2/c15-9-10(16)12(18)8-7(11(9)17)13(19)5-3-1-2-4-6(5)14(8)20/h1-4H,17-18H2

InChIKey

KZYAYVSWIPZDKL-UHFFFAOYSA-N

LogP

4.09560

Topological Polar Surface Area

86.18 Ų

Hydrogen Bond Donor/Acceptor

4 / 4

Synonyms & References

English

  • 1,4-Diamino-2,3-dichloroanthracene-9,10-dione
  • Transparent Violet 2BR
  • SOLVENT VIOLET 31
  • 1,4-Diamino-2,3-dichloro-9,10-anthraquinone

FAQ

What are the physical and chemical properties of 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is a crystalline compound with a molecular weight of approximately 413.04 g/mol. It is poorly soluble in water but soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). The compound is known for its reactivity, particularly in its ability to form complexes with metal ions and its use as a chromophore in spectroscopy. Additionally, it exhibits photochemical properties useful in photodetection applications.

How is 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3) typically synthesized?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is typically synthesized by the condensation of dichloroanthracene and hydrazine in an acidic medium. The process involves the controlled substitution and amination reactions, yielding the compound in moderate to good yield. Catalysts such as sulfuric acid or p-toluenesulfonic acid are commonly used to improve the reaction selectivity and yield. The process is performed under mild conditions to avoid decomposition of the intermediate products.

What industries use 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione finds applications in various industries due to its unique chemical properties. It is primarily used in the pharmaceutical sector for its potential as a photodynamic therapy agent. Additionally, it is utilized in the semiconductor industry for its photoelectrical properties and in the development of sensors for detecting various analytes in environmental and biomedical applications.

What precautions should be taken when handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

When handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, strict safety measures should be followed. Wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. This compound should be handled in a fume hood to minimize exposure to fumes and aerosols. In case of a spill, it should be cleaned up immediately using appropriate containment materials. Always consult the Safety Data Sheet (SDS) for detailed handling and emergency procedures. Due to its reactivity, proper storage in a cool, dry place away from direct sunlight is essential.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...