Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

Answer

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid
4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS number 906353-00-2. It is an organic compound with a molecular structure that includes a benzene ring, an oxygenated pyrazine group, and a carboxylic acid group. This compound is characterized by its acidic properties and has a melting point of around 224-226°C.

About

English Name 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid
Molecular Formula C12H10N2O3
Molecular Weight 230.22 g/mol
SMILES CC1=CN=CC(=N1)OC2=CC=C(C=C2)C(=O)O
InChIKey PPGBPVGCYRDKMI-UHFFFAOYSA-N
Last Updated: 2026-04-03 20:39

Related Q&A

Compound Q&A

What are the main uses of 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is primarily used in the pharmaceutical industry as an int...

Compound Q&A

Is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2) safe?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2) is generally considered safe when used ...

Compound Q&A

How should 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2) be stored?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid should be stored in a cool, dry place away from direct hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...