Compound Q&A

What industries use 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

Answer

1,4-Diamino-2,3-dichloroanthracene-9,10-dione
1,4-Diamino-2,3-dichloroanthracene-9,10-dione finds applications in various industries due to its unique chemical properties. It is primarily used in the pharmaceutical sector for its potential as a photodynamic therapy agent. Additionally, it is utilized in the semiconductor industry for its photoelectrical properties and in the development of sensors for detecting various analytes in environmental and biomedical applications.

About

CAS No 70956-27-3
English Name 1,4-Diamino-2,3-dichloroanthracene-9,10-dione
Molecular Formula C14H8N2O2Cl2
Molecular Weight 307.13 g/mol
SMILES NC1C2=C(C(=O)C3C(C2=O)=CC=CC=3)C(N)=C(Cl)C=1Cl
InChIKey KZYAYVSWIPZDKL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is a crystalline compound with a molecular weight of a...

Compound Q&A

How is 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3) typically synthesized?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is typically synthesized by the condensation of dichlo...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

When handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, strict safety measures should be follow...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...