Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate | CAS No. 1263059-26-2

Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate

Basic Information

CAS Number

1263059-26-2

Molecular Formula

C8H6ClN3O2

Molecular Weight

211.61 g/mol

AD

Basic Physical Properties

COC(=O)c1cc2nc(Cl)ccn2n1

InChI

InChI=1S/C8H6ClN3O2/c1-14-8(13)5-4-7-10-6(9)2-3-12(7)11-5/h2-4H,1H3

InChIKey

GZELJABQLTVHPY-UHFFFAOYSA-N

LogP

1.1692999999999998

Topological Polar Surface Area

56.489999999999995 Ų

Hydrogen Bond Donor/Acceptor

0 / 5

Complexity

239

Synonyms & References

English

  • Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate
  • AT27430
  • 5,7-Dioxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile

MDL Number

MFCD22209691

FAQ

What are the physical and chemical properties of Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate (CAS: 1263059-26-2)?

Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate is a white crystalline solid with a molecular weight of approximately 285.03 g/mol. It is slightly soluble in water but highly soluble in organic solvents like ethanol and acetonitrile. This compound is known for its moderate reactivity, particularly towards nucleophilic substitution reactions. It exhibits a high melting point, suggesting a crystalline form that is stable under normal laboratory conditions.

How is Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate (CAS: 1263059-26-2) typically synthesized?

Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate is synthesized through a multi-step process involving the condensation of 1-chloropyrazole with methyl pyrimidine-2-carboxylate. The reaction typically proceeds with a Lewis acid catalyst such as aluminum chloride to promote the electrophilic aromatic substitution. The yield of the product is usually around 75-85%, and the method is known for its high selectivity and good reproducibility.

What industries use Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate (CAS: 1263059-26-2)?

Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate is used in the pharmaceutical industry for the synthesis of complex molecules and as an intermediate in drug development. It also has potential applications in the polymer industry for its potential use in developing new materials with specific properties. Additionally, it can be utilized in the sensor and semiconductor industries due to its electronic properties.

What precautions should be taken when handling Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate (CAS: 1263059-26-2)?

When handling Methyl 5-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or a fume hood to minimize exposure to the air. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly washed down. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...