Compound Q&A

How is 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3) typically synthesized?

Answer

1,4-Diamino-2,3-dichloroanthracene-9,10-dione
1,4-Diamino-2,3-dichloroanthracene-9,10-dione is typically synthesized by the condensation of dichloroanthracene and hydrazine in an acidic medium. The process involves the controlled substitution and amination reactions, yielding the compound in moderate to good yield. Catalysts such as sulfuric acid or p-toluenesulfonic acid are commonly used to improve the reaction selectivity and yield. The process is performed under mild conditions to avoid decomposition of the intermediate products.

About

CAS No 70956-27-3
English Name 1,4-Diamino-2,3-dichloroanthracene-9,10-dione
Molecular Formula C14H8N2O2Cl2
Molecular Weight 307.13 g/mol
SMILES NC1C2=C(C(=O)C3C(C2=O)=CC=CC=3)C(N)=C(Cl)C=1Cl
InChIKey KZYAYVSWIPZDKL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is a crystalline compound with a molecular weight of a...

Compound Q&A

What industries use 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione finds applications in various industries due to its un...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

When handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, strict safety measures should be follow...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...