Compound Q&A

What precautions should be taken when handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

Answer

1,4-Diamino-2,3-dichloroanthracene-9,10-dione
When handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, strict safety measures should be followed. Wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. This compound should be handled in a fume hood to minimize exposure to fumes and aerosols. In case of a spill, it should be cleaned up immediately using appropriate containment materials. Always consult the Safety Data Sheet (SDS) for detailed handling and emergency procedures. Due to its reactivity, proper storage in a cool, dry place away from direct sunlight is essential.

About

CAS No 70956-27-3
English Name 1,4-Diamino-2,3-dichloroanthracene-9,10-dione
Molecular Formula C14H8N2O2Cl2
Molecular Weight 307.13 g/mol
SMILES NC1C2=C(C(=O)C3C(C2=O)=CC=CC=3)C(N)=C(Cl)C=1Cl
InChIKey KZYAYVSWIPZDKL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is a crystalline compound with a molecular weight of a...

Compound Q&A

How is 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3) typically synthesized?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is typically synthesized by the condensation of dichlo...

Compound Q&A

What industries use 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione finds applications in various industries due to its un...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...