Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

Answer

1,4-Diamino-2,3-dichloroanthracene-9,10-dione
1,4-Diamino-2,3-dichloroanthracene-9,10-dione is a crystalline compound with a molecular weight of approximately 413.04 g/mol. It is poorly soluble in water but soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). The compound is known for its reactivity, particularly in its ability to form complexes with metal ions and its use as a chromophore in spectroscopy. Additionally, it exhibits photochemical properties useful in photodetection applications.

About

CAS No 70956-27-3
English Name 1,4-Diamino-2,3-dichloroanthracene-9,10-dione
Molecular Formula C14H8N2O2Cl2
Molecular Weight 307.13 g/mol
SMILES NC1C2=C(C(=O)C3C(C2=O)=CC=CC=3)C(N)=C(Cl)C=1Cl
InChIKey KZYAYVSWIPZDKL-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3) typically synthesized?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione is typically synthesized by the condensation of dichlo...

Compound Q&A

What industries use 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

1,4-Diamino-2,3-dichloroanthracene-9,10-dione finds applications in various industries due to its un...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione (CAS: 70956-27-3)?

When handling 1,4-Diamino-2,3-dichloroanthracene-9,10-dione, strict safety measures should be follow...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...