L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine | CAS No. 307297-39-8

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine

Basic Information

CAS Number

307297-39-8

Molecular Formula

C14H22N4O9

Molecular Weight

390.35 g/mol

AD

Basic Physical Properties

C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N

InChI

InChI=1S/C14H22N4O9/c1-6(15)12(25)17-7(2-3-9(19)20)14(27)18-8(4-10(21)22)13(26)16-5-11(23)24/h6-8H,2-5,15H2,1H3,(H,16,26)(H,17,25)(H,18,27)(H,19,20)(H,21,22)(H,23,24)/t6-,7-,8-/m0/s1

InChIKey

HGHOBRRUMWJWCU-FXQIFTODSA-N

LogP

-3.1564999999999968

Topological Polar Surface Area

225.21999999999997 Ų

Hydrogen Bond Donor/Acceptor

8 / 13

Synonyms & References

English

  • Glycine, L-alanyl-L-a-glutamyl-L-a-aspartyl-
  • Epitalon
  • Epithalon
  • L-alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine

MDL Number

MFCD04034655

FAQ

What are the physical and chemical properties of L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is a crystalline compound with a molecular weight of approximately 419.48 g/mol. It has a high solubility in water and is slightly soluble in ethanol. The compound is known for its reactivity with amino acids and peptides, making it suitable for various chemical synthesis applications. Its physicochemical properties are advantageous for its use in pharmaceutical and biotechnological research.

How is L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) typically synthesized?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is typically synthesized through multi-step peptide coupling reactions involving L-alanine, L-glutamic acid, and L-aspartic acid. The synthesis process often involves the use of protecting groups, such as Boc or Fmoc, to control reactivity. The final product is obtained with high yield and selectivity, making it a valuable intermediate in peptide synthesis.

What industries use L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is primarily used in the pharmaceutical and biotechnological industries. It serves as an important building block in the synthesis of peptides and proteins, which are crucial for drug development and therapeutic applications. Additionally, it finds applications in cosmetics and food additives due to its functional properties.

What precautions should be taken when handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

When handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. In case of a spill, immediately clean up using appropriate methods and ensure proper disposal. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...