Compound Q&A

What precautions should be taken when handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

Answer

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
When handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. In case of a spill, immediately clean up using appropriate methods and ensure proper disposal. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
Molecular Formula C14H22N4O9
Molecular Weight 390.35 g/mol
SMILES C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N
InChIKey HGHOBRRUMWJWCU-FXQIFTODSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is a crystalline compound with ...

Compound Q&A

How is L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) typically synthesized?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is typically synthesized throug...

Compound Q&A

What industries use L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is primarily used in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...