Compound Q&A

What are the physical and chemical properties of L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

Answer

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is a crystalline compound with a molecular weight of approximately 419.48 g/mol. It has a high solubility in water and is slightly soluble in ethanol. The compound is known for its reactivity with amino acids and peptides, making it suitable for various chemical synthesis applications. Its physicochemical properties are advantageous for its use in pharmaceutical and biotechnological research.

About

English Name L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
Molecular Formula C14H22N4O9
Molecular Weight 390.35 g/mol
SMILES C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N
InChIKey HGHOBRRUMWJWCU-FXQIFTODSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) typically synthesized?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is typically synthesized throug...

Compound Q&A

What industries use L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

When handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...