Compound Q&A

How is L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) typically synthesized?

Answer

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is typically synthesized through multi-step peptide coupling reactions involving L-alanine, L-glutamic acid, and L-aspartic acid. The synthesis process often involves the use of protecting groups, such as Boc or Fmoc, to control reactivity. The final product is obtained with high yield and selectivity, making it a valuable intermediate in peptide synthesis.

About

English Name L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
Molecular Formula C14H22N4O9
Molecular Weight 390.35 g/mol
SMILES C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N
InChIKey HGHOBRRUMWJWCU-FXQIFTODSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is a crystalline compound with ...

Compound Q&A

What industries use L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

When handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...