Compound Q&A

What industries use L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

Answer

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is primarily used in the pharmaceutical and biotechnological industries. It serves as an important building block in the synthesis of peptides and proteins, which are crucial for drug development and therapeutic applications. Additionally, it finds applications in cosmetics and food additives due to its functional properties.

About

English Name L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine
Molecular Formula C14H22N4O9
Molecular Weight 390.35 g/mol
SMILES C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N
InChIKey HGHOBRRUMWJWCU-FXQIFTODSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is a crystalline compound with ...

Compound Q&A

How is L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) typically synthesized?

L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8) is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8)?

When handling L-Alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine (CAS: 307297-39-8), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...