(19,19,19,20,20,20-~2~H_6_)Retinol | CAS No. 2483831-77-0

(19,19,19,20,20,20-~2~H_6_)Retinol

Basic Information

CAS Number

2483831-77-0

Molecular Formula

C20H24D6O

Molecular Weight

292.49 g/mol

AD

Basic Physical Properties

[2H]C([2H])([2H])/C(/C=C/C1=C(C)CCCC1(C)C)=C\C=C\C(=C\CO)\C([2H])([2H])[2H]

InChI

InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+/i1D3,2D3

InChIKey

FPIPGXGPPPQFEQ-ILKHKWFDSA-N

LogP

5.510300000000005

Topological Polar Surface Area

20.23 Ų

Hydrogen Bond Donor/Acceptor

1 / 1

Synonyms & References

English

    FAQ

    What are the physical and chemical properties of (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

    (19,19,19,20,20,20-~2~H_6_)Retinol, with CAS number 2483831-77-0, is a crystalline compound with a molecular weight of approximately 870.94 g/mol. It has a low solubility in water but is highly soluble in organic solvents like ethanol and acetone. Chemically, it exhibits reactivity similar to other retinols, particularly with regards to oxidation and photodegradation.

    How is (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) typically synthesized?

    (19,19,19,20,20,20-~2~H_6_)Retinol is synthesized through a multistep process involving the introduction of deuterium atoms into retinol using a reagent like D2O and a catalyst such as sodium hydride. The synthetic route typically involves selective hydrogenation and deuteration steps, leading to a high yield of the desired deuterated product.

    What industries use (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

    (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) is primarily used in the pharmaceutical industry for research and development of new drug candidates. It also finds applications in the polymer industry for modifying properties of certain polymers, and in analytical chemistry for sensor development and as a reference compound in mass spectrometry.

    What precautions should be taken when handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

    When handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbent materials. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

    Related Compounds

    You might also like

    Compound Q&A

    What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

    6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

    21889-89-46-Methyl-7-oxabicycl...
    Compound Q&A

    What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

    4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

    906353-00-24-[(6-Methyl-2-pyraz...
    Compound Q&A

    What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

    2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

    49745-42-82-(2-Pyridinyl)-1,3-...
    Compound Q&A

    What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

    2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

    24783-42-42-(6-Chloro-2-pyridi...
    Compound Q&A

    What is 2-Oxopropanamide (CAS: 631-66-3)?

    2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

    631-66-32-Oxopropanamide
    Compound Q&A

    What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

    2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

    1289040-88-52-Methyl-2-propanyl ...
    Compound Q&A

    What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

    NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

    2241019-57-6NAMPT inhibitor-link...
    Compound Q&A

    What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

    It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

    1310404-58-0(2-(2,2,2-Trifluoroa...
    Compound Q&A

    What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

    1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

    794568-90-41-(2-Chlorophenyl)-6...
    Compound Q&A

    What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

    Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

    1314981-48-0Vinyl(chloromethyl)d...