Compound Q&A

What industries use (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

Answer

(19,19,19,20,20,20-~2~H_6_)Retinol
(19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) is primarily used in the pharmaceutical industry for research and development of new drug candidates. It also finds applications in the polymer industry for modifying properties of certain polymers, and in analytical chemistry for sensor development and as a reference compound in mass spectrometry.

About

English Name (19,19,19,20,20,20-~2~H_6_)Retinol
Molecular Formula C20H24D6O
Molecular Weight 292.49 g/mol
SMILES [2H]C([2H])([2H])/C(/C=C/C1=C(C)CCCC1(C)C)=C\C=C\C(=C\CO)\C([2H])([2H])[2H]
InChIKey FPIPGXGPPPQFEQ-ILKHKWFDSA-N
Last Updated: 2026-04-02 05:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

(19,19,19,20,20,20-~2~H_6_)Retinol, with CAS number 2483831-77-0, is a crystalline compound with a m...

Compound Q&A

How is (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) typically synthesized?

(19,19,19,20,20,20-~2~H_6_)Retinol is synthesized through a multistep process involving the introduc...

Compound Q&A

What precautions should be taken when handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

When handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...