Compound Q&A

How is (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) typically synthesized?

Answer

(19,19,19,20,20,20-~2~H_6_)Retinol
(19,19,19,20,20,20-~2~H_6_)Retinol is synthesized through a multistep process involving the introduction of deuterium atoms into retinol using a reagent like D2O and a catalyst such as sodium hydride. The synthetic route typically involves selective hydrogenation and deuteration steps, leading to a high yield of the desired deuterated product.

About

English Name (19,19,19,20,20,20-~2~H_6_)Retinol
Molecular Formula C20H24D6O
Molecular Weight 292.49 g/mol
SMILES [2H]C([2H])([2H])/C(/C=C/C1=C(C)CCCC1(C)C)=C\C=C\C(=C\CO)\C([2H])([2H])[2H]
InChIKey FPIPGXGPPPQFEQ-ILKHKWFDSA-N
Last Updated: 2026-04-02 05:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

(19,19,19,20,20,20-~2~H_6_)Retinol, with CAS number 2483831-77-0, is a crystalline compound with a m...

Compound Q&A

What industries use (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

(19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

When handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...