Compound Q&A

What are the physical and chemical properties of (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

Answer

(19,19,19,20,20,20-~2~H_6_)Retinol
(19,19,19,20,20,20-~2~H_6_)Retinol, with CAS number 2483831-77-0, is a crystalline compound with a molecular weight of approximately 870.94 g/mol. It has a low solubility in water but is highly soluble in organic solvents like ethanol and acetone. Chemically, it exhibits reactivity similar to other retinols, particularly with regards to oxidation and photodegradation.

About

English Name (19,19,19,20,20,20-~2~H_6_)Retinol
Molecular Formula C20H24D6O
Molecular Weight 292.49 g/mol
SMILES [2H]C([2H])([2H])/C(/C=C/C1=C(C)CCCC1(C)C)=C\C=C\C(=C\CO)\C([2H])([2H])[2H]
InChIKey FPIPGXGPPPQFEQ-ILKHKWFDSA-N
Last Updated: 2026-04-02 05:05

Related Q&A

Compound Q&A

How is (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) typically synthesized?

(19,19,19,20,20,20-~2~H_6_)Retinol is synthesized through a multistep process involving the introduc...

Compound Q&A

What industries use (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

(19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

When handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...