Compound Q&A

What precautions should be taken when handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

Answer

(19,19,19,20,20,20-~2~H_6_)Retinol
When handling (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbent materials. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name (19,19,19,20,20,20-~2~H_6_)Retinol
Molecular Formula C20H24D6O
Molecular Weight 292.49 g/mol
SMILES [2H]C([2H])([2H])/C(/C=C/C1=C(C)CCCC1(C)C)=C\C=C\C(=C\CO)\C([2H])([2H])[2H]
InChIKey FPIPGXGPPPQFEQ-ILKHKWFDSA-N
Last Updated: 2026-04-02 05:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

(19,19,19,20,20,20-~2~H_6_)Retinol, with CAS number 2483831-77-0, is a crystalline compound with a m...

Compound Q&A

How is (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) typically synthesized?

(19,19,19,20,20,20-~2~H_6_)Retinol is synthesized through a multistep process involving the introduc...

Compound Q&A

What industries use (19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0)?

(19,19,19,20,20,20-~2~H_6_)Retinol (CAS: 2483831-77-0) is primarily used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...