{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid | CAS No. 1061605-21-7

{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid

Basic Information

CAS Number

1061605-21-7

Molecular Formula

C15H12N2O7

Molecular Weight

332.27 g/mol

AD

Basic Physical Properties

OC(=O)COc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c21

InChI

InChI=1S/C15H12N2O7/c18-10-5-4-8(13(21)16-10)17-14(22)7-2-1-3-9(12(7)15(17)23)24-6-11(19)20/h1-3,8H,4-6H2,(H,19,20)(H,16,18,21)

InChIKey

ZVWIXIGBWIEDFO-UHFFFAOYSA-N

LogP

-0.4487999999999998

Topological Polar Surface Area

130.07999999999998 Ų

Hydrogen Bond Donor/Acceptor

2 / 9

Synonyms & References

English

  • E3 ligase Ligand 3
  • Thalidomide-O-COOH

MDL Number

MFCD31560477

FAQ

What are the physical and chemical properties of (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

The compound has a crystalline form and a molecular weight of approximately 336.36 g/mol. It is poorly soluble in water but easily soluble in organic solvents like methanol and acetonitrile. The compound is reactive towards nucleophiles and can undergo esterification and condensation reactions. It has a melting point of approximately 220-225°C and is stable under normal storage conditions.

How is (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7) typically synthesized?

The compound can be synthesized via the condensation of 2,6-dioxopiperidine-3-carboxylic acid and 1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl acetic acid. This process involves the use of an appropriate catalyst to enhance the reactivity and yield. The product is typically obtained with good selectivity and high yield under mild conditions.

What industries use (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

This compound finds applications in the pharmaceutical industry for its potential use as an intermediate in the synthesis of API (active pharmaceutical ingredients). It is also utilized in the polymer industry for enhancing the properties of certain polymers. Additionally, it has potential applications in the sensor and semiconductor industries due to its chemical reactivity and functional groups.

What precautions should be taken when handling (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

When handling the compound, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Ensure that the work is conducted in a well-ventilated area or a fume hood to avoid inhalation of dust or vapors. Spills should be cleaned up using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...