Compound Q&A

What precautions should be taken when handling (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

Answer

{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
When handling the compound, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Ensure that the work is conducted in a well-ventilated area or a fume hood to avoid inhalation of dust or vapors. Spills should be cleaned up using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name {[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
Molecular Formula C15H12N2O7
Molecular Weight 332.27 g/mol
SMILES OC(=O)COc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c21
InChIKey ZVWIXIGBWIEDFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

The compound has a crystalline form and a molecular weight of approximately 336.36 g/mol. It is poor...

Compound Q&A

How is (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7) typically synthesized?

The compound can be synthesized via the condensation of 2,6-dioxopiperidine-3-carboxylic acid and 1,...

Compound Q&A

What industries use (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

This compound finds applications in the pharmaceutical industry for its potential use as an intermed...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...