Compound Q&A

What industries use (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

Answer

{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
This compound finds applications in the pharmaceutical industry for its potential use as an intermediate in the synthesis of API (active pharmaceutical ingredients). It is also utilized in the polymer industry for enhancing the properties of certain polymers. Additionally, it has potential applications in the sensor and semiconductor industries due to its chemical reactivity and functional groups.

About

English Name {[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
Molecular Formula C15H12N2O7
Molecular Weight 332.27 g/mol
SMILES OC(=O)COc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c21
InChIKey ZVWIXIGBWIEDFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

The compound has a crystalline form and a molecular weight of approximately 336.36 g/mol. It is poor...

Compound Q&A

How is (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7) typically synthesized?

The compound can be synthesized via the condensation of 2,6-dioxopiperidine-3-carboxylic acid and 1,...

Compound Q&A

What precautions should be taken when handling (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

When handling the compound, appropriate personal protective equipment (PPE) such as gloves, goggles,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...