Compound Q&A

How is (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7) typically synthesized?

Answer

{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
The compound can be synthesized via the condensation of 2,6-dioxopiperidine-3-carboxylic acid and 1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl acetic acid. This process involves the use of an appropriate catalyst to enhance the reactivity and yield. The product is typically obtained with good selectivity and high yield under mild conditions.

About

English Name {[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
Molecular Formula C15H12N2O7
Molecular Weight 332.27 g/mol
SMILES OC(=O)COc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c21
InChIKey ZVWIXIGBWIEDFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

The compound has a crystalline form and a molecular weight of approximately 336.36 g/mol. It is poor...

Compound Q&A

What industries use (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

This compound finds applications in the pharmaceutical industry for its potential use as an intermed...

Compound Q&A

What precautions should be taken when handling (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

When handling the compound, appropriate personal protective equipment (PPE) such as gloves, goggles,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...