Compound Q&A

What are the physical and chemical properties of (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

Answer

{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
The compound has a crystalline form and a molecular weight of approximately 336.36 g/mol. It is poorly soluble in water but easily soluble in organic solvents like methanol and acetonitrile. The compound is reactive towards nucleophiles and can undergo esterification and condensation reactions. It has a melting point of approximately 220-225°C and is stable under normal storage conditions.

About

English Name {[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}acetic acid
Molecular Formula C15H12N2O7
Molecular Weight 332.27 g/mol
SMILES OC(=O)COc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c21
InChIKey ZVWIXIGBWIEDFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7) typically synthesized?

The compound can be synthesized via the condensation of 2,6-dioxopiperidine-3-carboxylic acid and 1,...

Compound Q&A

What industries use (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

This compound finds applications in the pharmaceutical industry for its potential use as an intermed...

Compound Q&A

What precautions should be taken when handling (2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl)oxyacetic acid (CAS: 1061605-21-7)?

When handling the compound, appropriate personal protective equipment (PPE) such as gloves, goggles,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...