Tungsten zirconium oxide (W2ZrO8) | CAS No. 16853-74-0

Q: What are the physical and chemical properties of Tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is a crystalline compound with a molecular weight of approximately 412.4 g/mol. It is insoluble in water but exhibits some solubility in strong acids. The material is chemically stable but can react with reducing agents at high temperatures. It is known for its high melting point and excellent thermal stability.

Q: How is tungsten zirconium oxide (CAS: 16853-74-0) typically synthesized?

Tungsten zirconium oxide (CAS: 16853-74-0) is typically synthesized through a solid-state reaction method. A mixture of tungsten oxide and zirconium oxide is heated to a high temperature, leading to the formation of the desired compound. This method allows for precise control over the composition and crystalline structure of the product.

Q: What industries use tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is used in various industries. It is a key component in catalysis for petrochemical processes, as a sintering aid in ceramics, and as a material for high-temperature applications in aerospace and automotive industries. Its properties make it suitable for sensors, catalyst supports, and as a component in advanced ceramic materials.

Q: What precautions should be taken when handling tungsten zirconium oxide (CAS: 16853-74-0)?

When handling tungsten zirconium oxide (CAS: 16853-74-0), appropriate personal protective equipment (PPE) such as gloves, safety goggles, and lab coats should be worn. This compound should be stored in a dry and well-ventilated area, away from flammable materials. In case of spillage, it should be carefully cleaned up using appropriate methods and the safety data sheet (SDS) should be consulted for specific handling instructions.

Tungsten zirconium oxide (W2ZrO8)

Basic Information

View in Editor

CAS Number

16853-74-0

Molecular Formula

O8W2Zr

Molecular Weight

586.9 g/mol

EINECS

240-876-3

Chemical Classification

Basic Chemical Raw Materials Organic Chemicals Carboxylic Acids

Water Treatment Chemicals Coagulants and Flocculants Inorganic Coagulants

Basic Physical Properties

Boiling Point

°Cat760mmHg

Density

5.10

Water Solubility

Insoluble in water.

SMILES

View in Editor

[O-][W](=O)(=O)[O-].[O-][W](=O)(=O)[O-].[Zr+4]

InChI

InChI=1S/4H2O.4O.2W.Zr/h4*1H2;;;;;;;/q;;;;4*-1;;;+4

InChIKey

SUCXOBKDTPWQDC-UHFFFAOYSA-N

LogP

-0.95040

Complexity

Synonyms & References

English

ZIRCONIUM TUNGSTATE
TUNGSTEN ZIRCONIUM OXIDE
ditungsten zirconium octaoxide
TUNGSTEN ZIRCONIUM OXIDE, 99.7% (METALS BASIS EXCLUDING HF),
99.7%(metalsbasisexcludingHf),Hf<0.3%
Tungsten zirconium oxide, 99.7% (metals basis excluding Hf), Hf <0.3%
Zirconium ditungstenoctaoxide
Zirconium tungstophosphoric acid，Zirconium tungstate
Zirconium tungstate
Zirconium Tungsten Oxide
(metalsbasisexcludingHf),Hf

MDL Number

MFCD00168096

EC Number

240-876-3

FAQ

What are the physical and chemical properties of Tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is a crystalline compound with a molecular weight of approximately 412.4 g/mol. It is insoluble in water but exhibits some solubility in strong acids. The material is chemically stable but can react with reducing agents at high temperatures. It is known for its high melting point and excellent thermal stability.

How is tungsten zirconium oxide (CAS: 16853-74-0) typically synthesized?

Tungsten zirconium oxide (CAS: 16853-74-0) is typically synthesized through a solid-state reaction method. A mixture of tungsten oxide and zirconium oxide is heated to a high temperature, leading to the formation of the desired compound. This method allows for precise control over the composition and crystalline structure of the product.

What industries use tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is used in various industries. It is a key component in catalysis for petrochemical processes, as a sintering aid in ceramics, and as a material for high-temperature applications in aerospace and automotive industries. Its properties make it suitable for sensors, catalyst supports, and as a component in advanced ceramic materials.

What precautions should be taken when handling tungsten zirconium oxide (CAS: 16853-74-0)?

When handling tungsten zirconium oxide (CAS: 16853-74-0), appropriate personal protective equipment (PPE) such as gloves, safety goggles, and lab coats should be worn. This compound should be stored in a dry and well-ventilated area, away from flammable materials. In case of spillage, it should be carefully cleaned up using appropriate methods and the safety data sheet (SDS) should be consulted for specific handling instructions.