Compound Q&A

What industries use tungsten zirconium oxide (CAS: 16853-74-0)?

Answer

Tungsten zirconium oxide (W2ZrO8)
Tungsten zirconium oxide (CAS: 16853-74-0) is used in various industries. It is a key component in catalysis for petrochemical processes, as a sintering aid in ceramics, and as a material for high-temperature applications in aerospace and automotive industries. Its properties make it suitable for sensors, catalyst supports, and as a component in advanced ceramic materials.

About

CAS No 16853-74-0
English Name Tungsten zirconium oxide (W2ZrO8)
Molecular Formula O8W2Zr
Molecular Weight 586.9 g/mol
EINECS 240-876-3
SMILES [O-][W](=O)(=O)[O-].[O-][W](=O)(=O)[O-].[Zr+4]
InChIKey SUCXOBKDTPWQDC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is a crystalline compound with a molecular weight of appr...

Compound Q&A

How is tungsten zirconium oxide (CAS: 16853-74-0) typically synthesized?

Tungsten zirconium oxide (CAS: 16853-74-0) is typically synthesized through a solid-state reaction m...

Compound Q&A

What precautions should be taken when handling tungsten zirconium oxide (CAS: 16853-74-0)?

When handling tungsten zirconium oxide (CAS: 16853-74-0), appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...