Compound Q&A

What precautions should be taken when handling tungsten zirconium oxide (CAS: 16853-74-0)?

Answer

Tungsten zirconium oxide (W2ZrO8)
When handling tungsten zirconium oxide (CAS: 16853-74-0), appropriate personal protective equipment (PPE) such as gloves, safety goggles, and lab coats should be worn. This compound should be stored in a dry and well-ventilated area, away from flammable materials. In case of spillage, it should be carefully cleaned up using appropriate methods and the safety data sheet (SDS) should be consulted for specific handling instructions.

About

CAS No 16853-74-0
English Name Tungsten zirconium oxide (W2ZrO8)
Molecular Formula O8W2Zr
Molecular Weight 586.9 g/mol
EINECS 240-876-3
SMILES [O-][W](=O)(=O)[O-].[O-][W](=O)(=O)[O-].[Zr+4]
InChIKey SUCXOBKDTPWQDC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is a crystalline compound with a molecular weight of appr...

Compound Q&A

How is tungsten zirconium oxide (CAS: 16853-74-0) typically synthesized?

Tungsten zirconium oxide (CAS: 16853-74-0) is typically synthesized through a solid-state reaction m...

Compound Q&A

What industries use tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is used in various industries. It is a key component in c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...