Compound Q&A

What are the physical and chemical properties of Tungsten zirconium oxide (CAS: 16853-74-0)?

Answer

Tungsten zirconium oxide (W2ZrO8)
Tungsten zirconium oxide (CAS: 16853-74-0) is a crystalline compound with a molecular weight of approximately 412.4 g/mol. It is insoluble in water but exhibits some solubility in strong acids. The material is chemically stable but can react with reducing agents at high temperatures. It is known for its high melting point and excellent thermal stability.

About

CAS No 16853-74-0
English Name Tungsten zirconium oxide (W2ZrO8)
Molecular Formula O8W2Zr
Molecular Weight 586.9 g/mol
EINECS 240-876-3
SMILES [O-][W](=O)(=O)[O-].[O-][W](=O)(=O)[O-].[Zr+4]
InChIKey SUCXOBKDTPWQDC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is tungsten zirconium oxide (CAS: 16853-74-0) typically synthesized?

Tungsten zirconium oxide (CAS: 16853-74-0) is typically synthesized through a solid-state reaction m...

Compound Q&A

What industries use tungsten zirconium oxide (CAS: 16853-74-0)?

Tungsten zirconium oxide (CAS: 16853-74-0) is used in various industries. It is a key component in c...

Compound Q&A

What precautions should be taken when handling tungsten zirconium oxide (CAS: 16853-74-0)?

When handling tungsten zirconium oxide (CAS: 16853-74-0), appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...