(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one | CAS No. 1261254-39-0

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one

Basic Information

CAS Number

1261254-39-0

Molecular Formula

C19H22D6O2

Molecular Weight

294.47 g/mol

AD

Basic Physical Properties

[2H]C1=C2[C@](CC([C@](C2([2H])[2H])([2H])O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3C1)CCC4=O)C)C

InChI

InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-16,20H,4-11H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1/i3D,7D2,11D2,13D

InChIKey

FMGSKLZLMKYGDP-BQXVJGQMSA-N

LogP

3.8792000000000026

Topological Polar Surface Area

37.3 Ų

Hydrogen Bond Donor/Acceptor

1 / 2

Synonyms & References

English

  • Dehydroepiandrosterone-[d6]
  • (3S,8R,9S,10R,13S,14S)-2,2,3,4,4,6-hexadeuterio-3-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-one
  • Dehydroepiandrosterone-d6

FAQ

What are the physical and chemical properties of (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is a crystalline solid with a molecular weight of approximately 424.58 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. Chemically, it is reactive towards nucleophiles and can undergo various transformations such as reduction and hydrogenation. It is stable under normal conditions but should be stored away from moisture and heat.

How is (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0) typically synthesized?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is synthesized through a multi-step process involving the reduction of androst-5-en-17-one followed by a hydroxylation step. Common catalysts include palladium or rhodium on a suitable support. The overall yield is moderate, around 50-70%, and the reaction is selective towards the desired product under optimized conditions.

What industries use (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one finds applications in the pharmaceutical industry, particularly in the development of hormonal drugs. It is also utilized in the production of certain polymers and in the development of sensor technologies. Its use in semiconductor manufacturing is less common but continues to be explored for its unique chemical properties.

What precautions should be taken when handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

When handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the use of a fume hood to minimize exposure to vapors. Spills should be immediately cleaned up using appropriate absorbents, and the area should be well-ventilated. Refer to the safety data sheet (SDS) for detailed emergency procedures and storage recommendations.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...