Compound Q&A

What are the physical and chemical properties of (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

Answer

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one
(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is a crystalline solid with a molecular weight of approximately 424.58 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. Chemically, it is reactive towards nucleophiles and can undergo various transformations such as reduction and hydrogenation. It is stable under normal conditions but should be stored away from moisture and heat.

About

English Name (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one
Molecular Formula C19H22D6O2
Molecular Weight 294.47 g/mol
SMILES [2H]C1=C2[C@](CC([C@](C2([2H])[2H])([2H])O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3C1)CCC4=O)C)C
InChIKey FMGSKLZLMKYGDP-BQXVJGQMSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

How is (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0) typically synthesized?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is synthesized through a multi-step proces...

Compound Q&A

What industries use (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one finds applications in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

When handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...