Compound Q&A

How is (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0) typically synthesized?

Answer

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one
(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is synthesized through a multi-step process involving the reduction of androst-5-en-17-one followed by a hydroxylation step. Common catalysts include palladium or rhodium on a suitable support. The overall yield is moderate, around 50-70%, and the reaction is selective towards the desired product under optimized conditions.

About

English Name (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one
Molecular Formula C19H22D6O2
Molecular Weight 294.47 g/mol
SMILES [2H]C1=C2[C@](CC([C@](C2([2H])[2H])([2H])O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3C1)CCC4=O)C)C
InChIKey FMGSKLZLMKYGDP-BQXVJGQMSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is a crystalline solid with a molecular we...

Compound Q&A

What industries use (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one finds applications in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

When handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...