Compound Q&A

What industries use (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

Answer

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one
(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one finds applications in the pharmaceutical industry, particularly in the development of hormonal drugs. It is also utilized in the production of certain polymers and in the development of sensor technologies. Its use in semiconductor manufacturing is less common but continues to be explored for its unique chemical properties.

About

English Name (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one
Molecular Formula C19H22D6O2
Molecular Weight 294.47 g/mol
SMILES [2H]C1=C2[C@](CC([C@](C2([2H])[2H])([2H])O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3C1)CCC4=O)C)C
InChIKey FMGSKLZLMKYGDP-BQXVJGQMSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is a crystalline solid with a molecular we...

Compound Q&A

How is (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0) typically synthesized?

(3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one is synthesized through a multi-step proces...

Compound Q&A

What precautions should be taken when handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one (CAS: 1261254-39-0)?

When handling (3beta)-3-Hydroxy(2,2,3,4,4,6-~2~H_6_)androst-5-en-17-one, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...