3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid

Basic Information

View in Editor

CAS Number

115025-90-6

Molecular Formula

C24H30O5

Molecular Weight

398.5 g/mol

Chemical Classification

Basic Chemical Raw Materials Organic Chemicals Carboxylic Acids

Basic Chemical Raw Materials Organic Chemicals Ethers

Basic Chemical Raw Materials Organic Chemicals Heterocyclic Compounds

Pharmaceutical Chemicals Pharmaceutical Intermediates Heterocyclic Intermediates

Fine Chemicals Dyes and Pigments Organic Dyes

Fine Chemicals Surfactants Anionic Surfactants

Basic Physical Properties

SMILES

View in Editor

c1ccc2c(c1)cccc2CCC(CCC3CCCCO3)(CC(=O)O)CC(=O)O

InChI

InChI=1S/C24H30O5/c25-22(26)16-24(17-23(27)28,14-12-20-9-3-4-15-29-20)13-11-19-8-5-7-18-6-1-2-10-21(18)19/h1-2,5-8,10,20H,3-4,9,11-17H2,(H,25,26)(H,27,28)

InChIKey

IMTYKPQOVURALK-UHFFFAOYSA-N

LogP

5.057500000000003

Topological Polar Surface Area

83.83 Å²

Hydrogen Bond Donor/Acceptor

2 / 5

Synonyms & References

English

Propanoic acid,1-(1-naphthalenyl)-3-(tetrahydro-2-furanyl)-
3-(2-naphthalen-1-ylethyl)-3-[2-(oxan-2-yl)ethyl]pentanedioic acid
3-(2-NAPHTHALEN-1-YL-ETHYL)-3-[2-(TETRAHYDRO-PYRAN-2-YL)-ETHYL]-PENTANEDIOIC ACID
2-Naphthalen-1-ylmethyl-2-(tetrahydro-furan-2-ylmethyl)-malonic acid
2-Naphthalen-1-ylmethyl-2-(tetrahydro-furan-2-ylmethyl)-malonic&nbsp
3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydrofuran-2-yl)ethyl]pentanedioic acid
3-[2-(naphthalen-1-yl)ethyl]-3-[2-(tetrahydrofuran-2-yl)ethyl]pentanedioic acid
pentanedioic acid, 3-[2-(1-naphthalenyl)ethyl]-3-[2-(tetrahydro-2-furanyl)ethyl]-

FAQ

What are the physical and chemical properties of 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid is a white to off-white crystalline solid with a molecular weight of approximately 514.5 g/mol. It is slightly soluble in water but highly soluble in organic solvents like ethanol and dimethylformamide. This compound is known for its reactivity in esterification reactions, making it useful in synthesizing various polymers and pharmaceuticals.

How is 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6) typically synthesized?

This compound can typically be synthesized via a multi-step process involving the condensation of 1-naphthylacetic acid and tetrahydro-2H-pyran-2-ol, followed by an esterification reaction. Common catalysts include strong acids like sulfuric acid, providing a high yield with good selectivity. The reaction conditions are carefully controlled to ensure optimal product formation and purity.

What industries use 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

This compound finds use in the pharmaceutical industry for the synthesis of certain drugs and intermediates, as well as in the polymer industry for developing new materials with specific properties. Its applications also extend to the production of sensors and semiconductors due to its unique chemical structure.

What precautions should be taken when handling 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using absorbent materials and disposing of the waste according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage guidelines.

Related Compounds

1,3-Dibromo-2,4-dichloro-5-fluorobenzene structure

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...

Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...

Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...

Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...

Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide

Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...

Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...

Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...

Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...

Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid | CAS No. 115025-90-6

Basic Information

CAS Number

Molecular Formula

Molecular Weight

Chemical Classification

Basic Physical Properties

Chemical Properties

SMILES

InChI

InChIKey

LogP

Topological Polar Surface Area

Hydrogen Bond Donor/Acceptor

Synonyms & References

English

FAQ

What are the physical and chemical properties of 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

How is 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6) typically synthesized?

What industries use 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

What precautions should be taken when handling 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

Related Compounds

You might also like

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

What is 2-Oxopropanamide (CAS: 631-66-3)?

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Supplier Information

Hubei Hanwei Chemical Co., Ltd.

ShenZhenAiTaHuaXue Co Ltd

JiangSuShengTaiKeGeChengHuaXue Co Ltd

JACS- ZhengZhouJieKeSiHuaGongChanPin Co Ltd

Jin Jinle (Hunan) Chemical Co., Ltd.

Product Inquiry