Compound Q&A

What precautions should be taken when handling 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

Answer

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid
When handling this compound, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using absorbent materials and disposing of the waste according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage guidelines.

About

English Name 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid
Molecular Formula C24H30O5
Molecular Weight 398.5 g/mol
SMILES c1ccc2c(c1)cccc2CCC(CCC3CCCCO3)(CC(=O)O)CC(=O)O
InChIKey IMTYKPQOVURALK-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid is a white to off-whi...

Compound Q&A

How is 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6) typically synthesized?

This compound can typically be synthesized via a multi-step process involving the condensation of 1-...

Compound Q&A

What industries use 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

This compound finds use in the pharmaceutical industry for the synthesis of certain drugs and interm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...