Compound Q&A

How is 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6) typically synthesized?

Answer

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid
This compound can typically be synthesized via a multi-step process involving the condensation of 1-naphthylacetic acid and tetrahydro-2H-pyran-2-ol, followed by an esterification reaction. Common catalysts include strong acids like sulfuric acid, providing a high yield with good selectivity. The reaction conditions are carefully controlled to ensure optimal product formation and purity.

About

English Name 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid
Molecular Formula C24H30O5
Molecular Weight 398.5 g/mol
SMILES c1ccc2c(c1)cccc2CCC(CCC3CCCCO3)(CC(=O)O)CC(=O)O
InChIKey IMTYKPQOVURALK-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid is a white to off-whi...

Compound Q&A

What industries use 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

This compound finds use in the pharmaceutical industry for the synthesis of certain drugs and interm...

Compound Q&A

What precautions should be taken when handling 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...