Compound Q&A

What industries use 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

Answer

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid
This compound finds use in the pharmaceutical industry for the synthesis of certain drugs and intermediates, as well as in the polymer industry for developing new materials with specific properties. Its applications also extend to the production of sensors and semiconductors due to its unique chemical structure.

About

English Name 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid
Molecular Formula C24H30O5
Molecular Weight 398.5 g/mol
SMILES c1ccc2c(c1)cccc2CCC(CCC3CCCCO3)(CC(=O)O)CC(=O)O
InChIKey IMTYKPQOVURALK-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid is a white to off-whi...

Compound Q&A

How is 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6) typically synthesized?

This compound can typically be synthesized via a multi-step process involving the condensation of 1-...

Compound Q&A

What precautions should be taken when handling 3-[2-(1-Naphthyl)ethyl]-3-[2-(tetrahydro-2H-pyran-2-yl)ethyl]pentanedioic acid (CAS: 115025-90-6)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...