2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide | CAS No. 878111-18-3

2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide

Basic Information

CAS Number

878111-18-3

Molecular Formula

C38H33O4P

Molecular Weight

584.65 g/mol

AD

Basic Physical Properties

Cc1cc(c(c(c1)C)c2cc3ccccc3c-4c2OP(=O)(Oc5c4c6ccccc6cc5c7c(cc(cc7C)C)C)O)C

InChI

InChI=1S/C38H33O4P/c1-21-15-23(3)33(24(4)16-21)31-19-27-11-7-9-13-29(27)35-36-30-14-10-8-12-28(30)20-32(34-25(5)17-22(2)18-26(34)6)38(36)42-43(39,40)41-37(31)35/h7-20H,1-6H3,(H,39,40)

InChIKey

BEHLZZISBCRGSO-UHFFFAOYSA-N

LogP

10.71611999999999

Topological Polar Surface Area

55.760000000000005 Ų

Hydrogen Bond Donor/Acceptor

1 / 4

Synonyms & References

English

  • (S)-4-oxide-4-hydroxy-2,6-bis(2,4,6-trimethylphenyl)-Dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin
  • (11bS)-4-Hydroxy-2,6-bis(2,4,6-trimethylphenyl)-4-oxide-dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin

MDL Number

MFCD31707595

FAQ

What are the physical and chemical properties of 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

This compound is a crystalline solid with a molecular weight of approximately 654.34 g/mol. It has moderate solubility in organic solvents like dichloromethane and diethyl ether. It exhibits limited reactivity under normal conditions but shows enhanced reactivity towards electron-rich aromatic compounds. It is stable under acidic and basic conditions but is sensitive to oxidizing agents.

How is 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3) typically synthesized?

This compound is typically synthesized through a multistep process involving condensation reactions of appropriate precursors. Commonly, it is synthesized from 2,6-dimesityl-1,3,2-dioxaphospholane followed by a ring expansion and oxidation. Special attention is given to the choice of solvents and catalysts to ensure high selectivity and yield.

What industries use 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It also finds applications in the polymer industry for the development of novel materials with specific functionalities. Additionally, it is used in sensor technology for detecting specific chemical species and in semiconductor manufacturing for etching and patterning processes.

What precautions should be taken when handling 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

Handling this compound should be done in a well-ventilated area or a fume hood to minimize inhalation exposure. Use gloves, safety glasses, and a lab coat to protect the skin and eyes. Store the compound in a cool, dry place away from direct sunlight. In case of a spill, immediately clean up using appropriate absorbent materials and follow the Material Safety Data Sheet (MSDS) for further guidance. Always wear personal protective equipment (PPE) and ensure good laboratory hygiene practices.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...