Compound Q&A

What industries use 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

Answer

2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide
This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It also finds applications in the polymer industry for the development of novel materials with specific functionalities. Additionally, it is used in sensor technology for detecting specific chemical species and in semiconductor manufacturing for etching and patterning processes.

About

English Name 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide
Molecular Formula C38H33O4P
Molecular Weight 584.65 g/mol
SMILES Cc1cc(c(c(c1)C)c2cc3ccccc3c-4c2OP(=O)(Oc5c4c6ccccc6cc5c7c(cc(cc7C)C)C)O)C
InChIKey BEHLZZISBCRGSO-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

This compound is a crystalline solid with a molecular weight of approximately 654.34 g/mol. It has m...

Compound Q&A

How is 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3) typically synthesized?

This compound is typically synthesized through a multistep process involving condensation reactions ...

Compound Q&A

What precautions should be taken when handling 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

Handling this compound should be done in a well-ventilated area or a fume hood to minimize inhalatio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...