Compound Q&A

What are the physical and chemical properties of 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

Answer

2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide
This compound is a crystalline solid with a molecular weight of approximately 654.34 g/mol. It has moderate solubility in organic solvents like dichloromethane and diethyl ether. It exhibits limited reactivity under normal conditions but shows enhanced reactivity towards electron-rich aromatic compounds. It is stable under acidic and basic conditions but is sensitive to oxidizing agents.

About

English Name 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide
Molecular Formula C38H33O4P
Molecular Weight 584.65 g/mol
SMILES Cc1cc(c(c(c1)C)c2cc3ccccc3c-4c2OP(=O)(Oc5c4c6ccccc6cc5c7c(cc(cc7C)C)C)O)C
InChIKey BEHLZZISBCRGSO-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3) typically synthesized?

This compound is typically synthesized through a multistep process involving condensation reactions ...

Compound Q&A

What industries use 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What precautions should be taken when handling 2,6-Dimesityldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-ol 4-oxide (CAS: 878111-18-3)?

Handling this compound should be done in a well-ventilated area or a fume hood to minimize inhalatio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...