Zn(ii) meso-tetra(4-carboxyphenyl) porphine | CAS No. 27647-84-3

Zn(ii) meso-tetra(4-carboxyphenyl) porphine

Basic Information

CAS Number

27647-84-3

Molecular Formula

C48H28N4O8Zn

Molecular Weight

854.1 g/mol

AD

Basic Physical Properties

C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=C(C=C9)C(=O)O)[N-]3)C(=O)O.[Zn+2]

InChI

InChI=1S/C48H30N4O8.Zn/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58;/h1-24H,(H6,49,50,51,52,53,54,55,56,57,58,59,60);/q;+2/p-2

InChIKey

IIEYPZOESLIZQB-UHFFFAOYSA-L

Complexity

1820

Synonyms & References

English

  • Zn(II)meso-Tetra(4-carboxyphenyl)Porphine
  • 27647-84-3
  • Zn(II) meso-Tetra(4-carboxyphenyl) Porphine
  • Zincate(4-),[[4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl-kN21,kN22,kN23,kN24)tetrakis[benzoato]](6-)]-,hydrogen (1:4), (SP-4-1)-
  • Zincate(4-),[[4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl-kN21,kN22,kN23,kN24)tetrakis[benzoato]](6-)]-,hydrogen (1:4)

MDL Number

MFCD27981355

FAQ

What are the physical and chemical properties of Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine is a crystalline compound with a molecular weight of approximately 496.32 g/mol. It has limited aqueous solubility but is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). This compound exhibits good stability towards many chemical reagents and possesses a unique electronic structure that makes it reactive in coordination chemistry and photochemistry applications.

How is Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3) typically synthesized?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine is commonly synthesized by ligand substitution reactions where a zinc salt reacts with meso-tetra(4-carboxyphenyl) porphyrin. This process often involves mild conditions and the use of organic solvents. The yield is typically around 80-90%, and the selectivity is high, making it a reliable method for preparing this compound.

What industries use Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine finds applications in various industries. It is used in pharmaceuticals for its photoactive properties, in polymer science for its ability to act as a photosensitizer, and in semiconductor technology for its electronic properties. Additionally, it is employed in sensor technology due to its ability to bind metal ions and change color, making it useful for sensing applications.

What precautions should be taken when handling Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

When handling Zn(ii) meso-tetra(4-carboxyphenyl) porphine, it is essential to use appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation of vapors. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal information.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...