Compound Q&A

What industries use Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

Answer

Zn(ii) meso-tetra(4-carboxyphenyl) porphine
Zn(ii) meso-tetra(4-carboxyphenyl) porphine finds applications in various industries. It is used in pharmaceuticals for its photoactive properties, in polymer science for its ability to act as a photosensitizer, and in semiconductor technology for its electronic properties. Additionally, it is employed in sensor technology due to its ability to bind metal ions and change color, making it useful for sensing applications.

About

CAS No 27647-84-3
English Name Zn(ii) meso-tetra(4-carboxyphenyl) porphine
Molecular Formula C48H28N4O8Zn
Molecular Weight 854.1 g/mol
SMILES C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=C(C=C9)C(=O)O)[N-]3)C(=O)O.[Zn+2]
InChIKey IIEYPZOESLIZQB-UHFFFAOYSA-L
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3) typically synthesized?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine is commonly synthesized by ligand substitution reactions...

Compound Q&A

What precautions should be taken when handling Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

When handling Zn(ii) meso-tetra(4-carboxyphenyl) porphine, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...