Compound Q&A

What are the physical and chemical properties of Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

Answer

Zn(ii) meso-tetra(4-carboxyphenyl) porphine
Zn(ii) meso-tetra(4-carboxyphenyl) porphine is a crystalline compound with a molecular weight of approximately 496.32 g/mol. It has limited aqueous solubility but is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). This compound exhibits good stability towards many chemical reagents and possesses a unique electronic structure that makes it reactive in coordination chemistry and photochemistry applications.

About

CAS No 27647-84-3
English Name Zn(ii) meso-tetra(4-carboxyphenyl) porphine
Molecular Formula C48H28N4O8Zn
Molecular Weight 854.1 g/mol
SMILES C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=C(C=C9)C(=O)O)[N-]3)C(=O)O.[Zn+2]
InChIKey IIEYPZOESLIZQB-UHFFFAOYSA-L
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3) typically synthesized?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine is commonly synthesized by ligand substitution reactions...

Compound Q&A

What industries use Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

Zn(ii) meso-tetra(4-carboxyphenyl) porphine finds applications in various industries. It is used in ...

Compound Q&A

What precautions should be taken when handling Zn(ii) meso-tetra(4-carboxyphenyl) porphine (CAS: 27647-84-3)?

When handling Zn(ii) meso-tetra(4-carboxyphenyl) porphine, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...