S-A-1 | CAS No. 216454-90-9

S-A-1

Basic Information

View in Editor

CAS Number

216454-90-9

Molecular Formula

C15H16N2

Molecular Weight

224.31 g/mol

Chemical Classification

Basic Chemical Raw Materials Organic Chemicals Amines

Basic Physical Properties

SMILES

View in Editor

CC1(C)C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2

InChI

InChI=1S/C15H16N2/c1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h3-8H,16-17H2,1-2H3

InChIKey

FUKMZONXXALQHQ-UHFFFAOYSA-N

LogP

3.157300000000001

Topological Polar Surface Area

52.04 Å²

Hydrogen Bond Donor/Acceptor

4 / 2

Synonyms & References

English

9,9-dimethyl-9H-fluorene-2,7-diamine
9H-Fluorene-2,7-diamine, 9,9-dimethyl-
9,9-dimethyl-9H-fluorene-2,7- diamine (S-A-1)

FAQ

What are the physical and chemical properties of S-A-1 (CAS: 216454-90-9)?

S-A-1 is a crystalline compound with a molecular weight of approximately 220.23 g/mol. It has poor water solubility but is soluble in common organic solvents like DMSO and acetonitrile. Chemically, S-A-1 is highly reactive towards nucleophiles and can undergo various transformations under specific conditions. It is stable under normal storage conditions but should be protected from moisture and light.

How is S-A-1 (CAS: 216454-90-9) typically synthesized?

S-A-1 is synthesized via a multistep process involving condensation reactions and derivatization steps. Commonly, it is prepared from readily available starting materials using a combination of organic solvents and catalysts. The synthesis typically yields a high purity product with good selectivity and yield, though specific details can vary depending on the exact route chosen.

What industries use S-A-1 (CAS: 216454-90-9)?

S-A-1 is primarily used in pharmaceuticals for its therapeutic potentials, particularly in cancer research and treatment. It also finds applications in polymer chemistry for modifying materials and in sensor technology for detecting specific chemical species. Additionally, it has potential uses in semiconductor fabrication due to its reactivity and stability under certain conditions.

What precautions should be taken when handling S-A-1 (CAS: 216454-90-9)?

When handling S-A-1, it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and laboratory coats. Handling should be done in a well-ventilated area or fume hood to minimize exposure to fumes. In case of a spill, it should be immediately contained and cleaned up using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures.