Compound Q&A

What precautions should be taken when handling S-A-1 (CAS: 216454-90-9)?

Answer

S-A-1
When handling S-A-1, it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and laboratory coats. Handling should be done in a well-ventilated area or fume hood to minimize exposure to fumes. In case of a spill, it should be immediately contained and cleaned up using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

English Name S-A-1
Molecular Formula C15H16N2
Molecular Weight 224.307 g/mol
SMILES CC1(C)C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2
InChIKey FUKMZONXXALQHQ-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-A-1 (CAS: 216454-90-9)?

S-A-1 is a crystalline compound with a molecular weight of approximately 220.23 g/mol. It has poor w...

Compound Q&A

How is S-A-1 (CAS: 216454-90-9) typically synthesized?

S-A-1 is synthesized via a multistep process involving condensation reactions and derivatization ste...

Compound Q&A

What industries use S-A-1 (CAS: 216454-90-9)?

S-A-1 is primarily used in pharmaceuticals for its therapeutic potentials, particularly in cancer re...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...