Compound Q&A

What industries use S-A-1 (CAS: 216454-90-9)?

Answer

S-A-1
S-A-1 is primarily used in pharmaceuticals for its therapeutic potentials, particularly in cancer research and treatment. It also finds applications in polymer chemistry for modifying materials and in sensor technology for detecting specific chemical species. Additionally, it has potential uses in semiconductor fabrication due to its reactivity and stability under certain conditions.

About

English Name S-A-1
Molecular Formula C15H16N2
Molecular Weight 224.307 g/mol
SMILES CC1(C)C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2
InChIKey FUKMZONXXALQHQ-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-A-1 (CAS: 216454-90-9)?

S-A-1 is a crystalline compound with a molecular weight of approximately 220.23 g/mol. It has poor w...

Compound Q&A

How is S-A-1 (CAS: 216454-90-9) typically synthesized?

S-A-1 is synthesized via a multistep process involving condensation reactions and derivatization ste...

Compound Q&A

What precautions should be taken when handling S-A-1 (CAS: 216454-90-9)?

When handling S-A-1, it is crucial to use appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...