(2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (1:1) | CAS No. 1447963-73-6

(2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (1:1)

Basic Information

CAS Number

1447963-73-6

Molecular Formula

C41H54N3O3PPdS

Molecular Weight

806.36 g/mol

AD

Basic Physical Properties

CN(C)c1cccc(c1c2ccccc2P(C3CCCCC3)C4CCCCC4)N(C)C.CS(=O)(=O)O[Pd]c1ccccc1c2ccccc2N

InChI

InChI=1S/C28H41N2P.C12H10N.CH4O3S.Pd/c1-29(2)25-19-13-20-26(30(3)4)28(25)24-18-11-12-21-27(24)31(22-14-7-5-8-15-22)23-16-9-6-10-17-23;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h11-13,18-23H,5-10,14-17H2,1-4H3;1-6,8-9H,13H2;1H3,(H,2,3,4);/q;;;+1/p-1

InChIKey

SMFSVINURNWOPR-UHFFFAOYSA-M

LogP

8.793000000000008

Topological Polar Surface Area

75.87 Ų

Hydrogen Bond Donor/Acceptor

2 / 6

Synonyms & References

English

    MDL Number

    MFCD22417226

    FAQ

    What are the physical and chemical properties of (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (CAS: 1447963-73-6)?

    This compound is a metal complex with a molecular weight of approximately 929.4 g/mol. It crystallizes in a specific form, typically as a pale solid. The compound has low solubility in common organic solvents but is soluble in polar aprotic solvents. It exhibits high reactivity towards nucleophiles and is stable under inert conditions. It is used as a catalyst in various organic reactions.

    How is (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (CAS: 1447963-73-6) typically synthesized?

    This complex is synthesized through the reaction of palladium(II) acetate with 2-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine and methanesulfonic acid. The reaction is typically performed under an inert atmosphere to prevent the palladium from oxidizing. The yield is generally around 80%, and the product is isolated by column chromatography.

    What industries use (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (CAS: 1447963-73-6)?

    This compound is primarily used in the pharmaceutical and chemical industries as a catalyst for various organic transformations. It is also used in the development of new materials, including polymers and semiconductors. Due to its reactivity, it finds applications in the synthesis of complex organic molecules and in the production of functional materials.

    What precautions should be taken when handling (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (CAS: 1447963-73-6)?

    Proper handling of this compound requires the use of personal protective equipment (PPE), including gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or a fume hood to prevent inhalation of any vapors. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be decontaminated. Always consult the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

    Related Compounds

    You might also like

    Compound Q&A

    What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

    6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

    21889-89-46-Methyl-7-oxabicycl...
    Compound Q&A

    What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

    4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

    906353-00-24-[(6-Methyl-2-pyraz...
    Compound Q&A

    What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

    2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

    49745-42-82-(2-Pyridinyl)-1,3-...
    Compound Q&A

    What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

    2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

    24783-42-42-(6-Chloro-2-pyridi...
    Compound Q&A

    What is 2-Oxopropanamide (CAS: 631-66-3)?

    2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

    631-66-32-Oxopropanamide
    Compound Q&A

    What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

    2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

    1289040-88-52-Methyl-2-propanyl ...
    Compound Q&A

    What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

    NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

    2241019-57-6NAMPT inhibitor-link...
    Compound Q&A

    What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

    It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

    1310404-58-0(2-(2,2,2-Trifluoroa...
    Compound Q&A

    What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

    1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

    794568-90-41-(2-Chlorophenyl)-6...
    Compound Q&A

    What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

    Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

    1314981-48-0Vinyl(chloromethyl)d...