Compound Q&A

What are the physical and chemical properties of (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (CAS: 1447963-73-6)?

Answer

(2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (1:1)
This compound is a metal complex with a molecular weight of approximately 929.4 g/mol. It crystallizes in a specific form, typically as a pale solid. The compound has low solubility in common organic solvents but is soluble in polar aprotic solvents. It exhibits high reactivity towards nucleophiles and is stable under inert conditions. It is used as a catalyst in various organic reactions.

About

English Name (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (1:1)
Molecular Formula C41H54N3O3PPdS
Molecular Weight 806.36 g/mol
SMILES CN(C)c1cccc(c1c2ccccc2P(C3CCCCC3)C4CCCCC4)N(C)C.CS(=O)(=O)O[Pd]c1ccccc1c2ccccc2N
InChIKey SMFSVINURNWOPR-UHFFFAOYSA-M
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What industries use (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - 2'-(dicyclohexylphosphino)-N,N,N',N'-tetramethyl-2,6-biphenyldiamine (CAS: 1447963-73-6)?

This compound is primarily used in the pharmaceutical and chemical industries as a catalyst for vari...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...