3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride | CAS No. 1373038-63-1

3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride

Basic Information

CAS Number

1373038-63-1

Molecular Formula

C16H11Cl2NO5S2

Molecular Weight

432.31 g/mol

AD

Basic Physical Properties

Solubility

Insuluble (3.1E-3 g/L) (25 ºC),

Cc1c(c(no1)c2cccc(c2)S(=O)(=O)Cl)c3ccc(cc3)S(=O)(=O)Cl

InChI

InChI=1S/C16H11Cl2NO5S2/c1-10-15(11-5-7-13(8-6-11)25(17,20)21)16(19-24-10)12-3-2-4-14(9-12)26(18,22)23/h2-9H,1H3

InChIKey

KDDCVZQQYUBTRK-UHFFFAOYSA-N

LogP

4.1720200000000025

Topological Polar Surface Area

94.31 Ų

Hydrogen Bond Donor/Acceptor

0 / 6

Complexity

695

Synonyms & References

English

  • Valdecoxib Impurity E
  • Parecoxib Impurity 27
  • 3-(4-(4-(Chlorosulfonyl)phenyl)-5-methylisoxazol-3-yl)benzene-1-sulfonyl chloride
  • 3-(4-(4-(Chlorosulfonyl)phenyl)-5-methylisoxazol-3-yl)benzenesulfonyl chloride
  • 3-[4-(4-Chlorosulfonylphenyl)-5-methyl-1,2-oxazol-3-yl]benzenesulfonyl chloride
  • 3-(4-(4-(chlorosulfonyl)phenyl)-5-methylisoxazol-3-yl)benzenesulfonyl chloride

FAQ

What are the physical and chemical properties of 3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride (CAS: 1373038-63-1)?

3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride is a crystalline solid with a molecular weight of approximately 522.04 g/mol. Its solubility in water is very low, making it suitable for applications requiring high purity. Chemically, it is highly reactive, particularly towards nucleophiles and bases, which can lead to coupling reactions and other transformations in synthetic chemistry.

How is 3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride (CAS: 1373038-63-1) typically synthesized?

3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride is synthesized through a multi-step process, often involving the condensation of a 4-chlorosulfonylphenyl derivative with a 5-methyl-1,2-oxazol-3-carboxylic acid compound. The reaction typically requires mild to moderate temperatures and is catalyzed by common reagents like sulfuric acid. The overall yield is generally between 60-80%, depending on the purity of the starting materials and the optimization of reaction conditions.

What industries use 3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride (CAS: 1373038-63-1)?

3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride finds applications in the pharmaceutical industry for the synthesis of complex molecules and intermediates. It is also used in polymer chemistry, where its reactive properties can be harnessed for functionalization and cross-linking. Additionally, this compound is employed in the development of sensors and semiconductors due to its unique chemical reactivity and stability.

What precautions should be taken when handling 3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride (CAS: 1373038-63-1)?

When handling 3-{4-[4-(Chlorosulfonyl)phenyl]-5-methyl-1,2-oxazol-3-yl}benzenesulfonyl chloride, it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work must be conducted in a well-ventilated area or a fume hood to minimize exposure to chlorosulfonyl groups. Spills should be cleaned up using appropriate absorbent materials and disposed of in accordance with local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

Related Compounds

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...