2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate | CAS No. 1107645-06-6

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate

Basic Information

CAS Number

1107645-06-6

Molecular Formula

C10H12BrNO3

Molecular Weight

274.11 g/mol

AD

Basic Physical Properties

N1(C(OC(C)(C)C)=O)C=C(Br)C=C1C=O

InChI

1S/C10H12BrNO3/c1-10(2,3)15-9(14)12-5-7(11)4-8(12)6-13/h4-6H,1-3H3

InChIKey

HYMQXYXWFQHZOO-UHFFFAOYSA-N

LogP

2.846300000000001

Topological Polar Surface Area

48.3 Ų

Hydrogen Bond Donor/Acceptor

0 / 4

Synonyms & References

English

  • 1H-Pyrrole-1-carboxylic acid, 4-bromo-2-formyl-, 1,1-dimethylethyl ester

FAQ

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is a crystalline compound with a molecular weight of approximately 259.04 g/mol. It is sparingly soluble in most common organic solvents but soluble in water. It shows moderate reactivity towards nucleophiles and electrophiles, making it useful in various synthetic transformations. The compound is stable under normal storage conditions but should be handled in a fume hood to avoid inhaling its vapors.

How is 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6) typically synthesized?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is typically synthesized using a multistep process involving the formation of a 2-formyl pyrrole ring followed by alkylation and bromination. Commonly, formylated pyrrole is reacted with 2-methyl-2-propanol in the presence of a suitable catalyst, followed by bromination to introduce the desired functional group. This method provides good yield and selectivity for this specific compound.

What industries use 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate finds applications in the pharmaceutical and polymer industries. It serves as a precursor in the development of novel drugs and is also used in the synthesis of advanced polymers with specific properties. Additionally, it can be employed in the manufacturing of sensors and semiconductors due to its unique chemical properties.

What precautions should be taken when handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

When handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate, it is essential to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to prevent inhalation of vapors. In case of a spill, immediately clean up using appropriate absorbent materials and follow proper waste disposal protocols. Always refer to the Safety Data Sheet (SDS) for comprehensive safety information.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...