Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

Answer

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate
2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is a crystalline compound with a molecular weight of approximately 259.04 g/mol. It is sparingly soluble in most common organic solvents but soluble in water. It shows moderate reactivity towards nucleophiles and electrophiles, making it useful in various synthetic transformations. The compound is stable under normal storage conditions but should be handled in a fume hood to avoid inhaling its vapors.

About

English Name 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate
Molecular Formula C10H12BrNO3
Molecular Weight 274.11 g/mol
SMILES N1(C(OC(C)(C)C)=O)C=C(Br)C=C1C=O
InChIKey HYMQXYXWFQHZOO-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6) typically synthesized?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is typically synthesized using a multi...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

When handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...