Compound Q&A

What industries use 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

Answer

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate
2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate finds applications in the pharmaceutical and polymer industries. It serves as a precursor in the development of novel drugs and is also used in the synthesis of advanced polymers with specific properties. Additionally, it can be employed in the manufacturing of sensors and semiconductors due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate
Molecular Formula C10H12BrNO3
Molecular Weight 274.11 g/mol
SMILES N1(C(OC(C)(C)C)=O)C=C(Br)C=C1C=O
InChIKey HYMQXYXWFQHZOO-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is a crystalline compound with a molec...

Compound Q&A

How is 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6) typically synthesized?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is typically synthesized using a multi...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

When handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...