Compound Q&A

How is 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6) typically synthesized?

Answer

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate
2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is typically synthesized using a multistep process involving the formation of a 2-formyl pyrrole ring followed by alkylation and bromination. Commonly, formylated pyrrole is reacted with 2-methyl-2-propanol in the presence of a suitable catalyst, followed by bromination to introduce the desired functional group. This method provides good yield and selectivity for this specific compound.

About

English Name 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate
Molecular Formula C10H12BrNO3
Molecular Weight 274.11 g/mol
SMILES N1(C(OC(C)(C)C)=O)C=C(Br)C=C1C=O
InChIKey HYMQXYXWFQHZOO-UHFFFAOYSA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate is a crystalline compound with a molec...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate (CAS: 1107645-06-6)?

When handling 2-Methyl-2-propanyl 4-bromo-2-formyl-1H-pyrrole-1-carboxylate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...